Write the structure for each of the following compounds. Check whether the naming is correct or incorrect based on the IUPAC name system. If it is wrong, state the error, then write the correct name.
a. 2-ethylpropane
b. 2-methyl-3-ethylpentane
c. 1,1,3-trimethylhexane
d. 2-ethylpropane
Guide On Rating System
Vote
a. 2-ethylpropane
The name is incorrect. According to the IUPAC rules, the longest carbon chain should be considered as the parent chain. In this case, the longest chain is 4 carbons long, not 3. Therefore, the correct name should be butane, not propane. The correct name for this compound is 2-methylbutane.
Structure: CH3-CH(CH3)-CH2-CH3
b. 2-methyl-3-ethylpentane
The name is correct. The longest carbon chain is 5 carbons long, which is named as pentane. There is a methyl group at the 2nd carbon and an ethyl group at the 3rd carbon.
Structure: CH3-CH(CH3)-CH(CH2CH3)-CH2-CH3
c. 1,1,3-trimethylhexane
The name is incorrect. According to the IUPAC rules, the numbering of the carbon atoms in the parent chain should start from the end nearest to the substituent group. In this case, the correct name should be 4,4-dimethyl-2-methylhexane.
Structure: CH3-C(CH3)2-CH(CH3)-CH2-CH2-CH3
d. 2-ethylpropane
The name is incorrect. According to the IUPAC rules, the longest carbon chain should be considered as the parent chain. In this case, the longest chain is 4 carbons long, not 3. Therefore, the correct name should be butane, not propane. The correct name for this compound is 2-methylbutane.
Structure: CH3-CH(CH3)-CH2-CH3
Got a question with my answer?
Cheapmath.com is completely free!
Asking question is free.
Getting answers is free.
+99